Home
Products
Bullatantriol
| Product Name | Bullatantriol |
| Price: | Inquiry |
| Catalog No.: | CN09370 |
| CAS No.: | 99933-32-1 |
| Molecular Formula: | C15H28O3 |
| Molecular Weight: | 256.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Acorus calamus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CC[C@]([C@H]2[C@@]1(C)CC[C@@H]2CC(O)(C)C)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 379.3±27.0 °C at 760 mmHg |
| Flash Point | 172.6±18.3 °C |
| Exact Mass | 256.203857 |
| PSA | 60.69000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |