Home
Products
Triptonoterpene
| Product Name | Triptonoterpene |
| Price: | Inquiry |
| Catalog No.: | CN08197 |
| CAS No.: | 99694-87-8 |
| Molecular Formula: | C20H28O2 |
| Molecular Weight: | 300.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Tripterygium wilfordii Hook. f. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(c1ccc2c(c1O)CC[C@@H]1[C@]2(C)CCC(=O)C1(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Triptonoterpene is a natural product that can be isolated from the roots of Tripterygium wilfordii Hook. f.[1]. |
| Exact Mass | 300.20900 |
| PSA | 37.30000 |
| LogP | 4.72480 |
| Storage condition | -20°C |