Home
Products
Cucurbitacin Q1
| Product Name | Cucurbitacin Q1 |
| Price: | $287 / 5mg |
| Catalog No.: | CN07162 |
| CAS No.: | 99530-82-2 |
| Molecular Formula: | C32H48O8 |
| Molecular Weight: | 560.72 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Hemsleya chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC(C=CC(=O)C(C1C(O)CC2(C1(C)CC(=O)C1(C2CC=C2C1CC(O)C(C2(C)C)O)C)C)(O)C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cucurbitacin Q1 is a tetracyclic triterpene that can be found in Cucumis prophetarum[1]. |
| Storage condition | 2-8℃ |