Home
Products
Methyl rosmarinate
| Product Name | Methyl rosmarinate |
| Price: | $234 / 10mg |
| Catalog No.: | CN06930 |
| CAS No.: | 99353-00-1 |
| Molecular Formula: | C19H18O8 |
| Molecular Weight: | 374.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rosmarinus officinalis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)[C@@H](Cc1ccc(c(c1)O)O)OC(=O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methyl rosmarinate is a noncompetitive tyrosinase inhibitor which is isolated from Rabdosia serra, with an IC50 of 0.28 mM for mushroom tyrosinase, and also inhibits a-glucosidase[1]. |
| Target | IC50: 0.28 mM (mushroom tyrosinase), a -glucosidase[1] |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 655.4±55.0 °C at 760 mmHg |
| Flash Point | 236.5±25.0 °C |
| Exact Mass | 374.100159 |
| PSA | 133.52000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |