Home
Products
Kushenol I
| Product Name | Kushenol I |
| Price: | $348 / 5mg |
| Catalog No.: | CN05153 |
| CAS No.: | 99119-69-4 |
| Molecular Formula: | C26H30O7 |
| Molecular Weight: | 454.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Sophora flavescens Ait. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c(c2c1C(=O)[C@H](O)[C@H](O2)c1ccc(cc1O)O)C[C@H](C(=C)C)CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kushenol I is a natural compound isolated from the roots of Sophora flavescens[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 676.2±55.0 °C at 760 mmHg |
| Flash Point | 230.9±25.0 °C |
| Exact Mass | 438.167847 |
| PSA | 131.36000 |
| LogP | 5.66 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |