Home
Products
Prunasin
| Product Name | Prunasin |
| Price: | $526 / 5mg |
| Catalog No.: | CN01392 |
| CAS No.: | 99-18-3 |
| Molecular Formula: | C14H17NO6 |
| Molecular Weight: | 295.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The leaves of Perilla frutescens |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H](c2ccccc2)C#N)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Prunasin is a inhibitor of DNA Polymerase β[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 527.0±50.0 °C at 760 mmHg |
| Flash Point | 272.5±30.1 °C |
| Exact Mass | 295.105591 |
| PSA | 123.17000 |
| LogP | -0.92 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |