Home
Products
3-Feruloyl-1-Sinapoyl sucrose
| Product Name | 3-Feruloyl-1-Sinapoyl sucrose |
| Price: | Inquiry |
| Catalog No.: | CN06791 |
| CAS No.: | 98942-06-4 |
| Molecular Formula: | C33H40O18 |
| Molecular Weight: | 724.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](O[C@@]2(COC(=O)/C=C/c3cc(OC)c(c(c3)OC)O)O[C@@H]([C@H]([C@@H]2OC(=O)/C=C/c2ccc(c(c2)OC)O)O)CO)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Feruloyl-1-Sinapoyl sucrose (compound 1) is a glycoside isolated from the aerial parts of Polygala chamaebuxus[1]. |