Home
Products
Pseudolaric acid A-O-beta-D-glucopyranoside
| Product Name | Pseudolaric acid A-O-beta-D-glucopyranoside |
| Price: | $351 / 10mg |
| Catalog No.: | CN08507 |
| CAS No.: | 98891-44-2 |
| Molecular Formula: | C28H38O11 |
| Molecular Weight: | 550.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The root bark of Pseudolarix amabilis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)/C(=C/C=C/[C@@]2(C)OC(=O)[C@]34[C@@]([C@H]2CC3)(CCC(=CC4)C)OC(=O)C)/C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudolaric acid A-O-β-D-glucopyranoside, isolated from Cortex Pseudolaricis, demonstrates antifungal and antifertility activities[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 730.4±60.0 °C at 760 mmHg |
| Flash Point | 237.2±26.4 °C |
| Exact Mass | 550.241394 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±5.4 mmHg at 25°C |