Home
Products
Pseudolaric acid B-O-beta-D-glucopyranoside
| Product Name | Pseudolaric acid B-O-beta-D-glucopyranoside |
| Price: | $146 / 20mg |
| Catalog No.: | CN08506 |
| CAS No.: | 98891-41-9 |
| Molecular Formula: | C29H38O13 |
| Molecular Weight: | 594.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Pseudolarix amabilis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)/C(=C/C=C/[C@@]2(C)OC(=O)[C@]34[C@@]([C@H]2CC3)(CCC(=CC4)C(=O)OC)OC(=O)C)/C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudolaric acid B β-D-glucoside is a diterpenoid isolated from Pseudolarix kaempferi[1]. |
| Density | 1.42±0.1 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 766.5±60.0℃ at 760 mmHg |
| Exact Mass | 594.23100 |
| PSA | 195.35000 |
| LogP | 0.12910 |