Home
Products
Ganoderic acid G
| Product Name | Ganoderic acid G |
| Price: | $176 / 5mg |
| Catalog No.: | CN07521 |
| CAS No.: | 98665-22-6 |
| Molecular Formula: | C30H44O8 |
| Molecular Weight: | 532.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)CC(C1CC(=O)C2(C1(C)C(OC(=O)C)C(=O)C1=C2C(=O)CC2C1(C)CCC(=O)C2(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid G is a triterpene isolated from the surface part of gills of Ganoderma lucidum[1]. |
| Density | 1.27g/cm3 |
| Boiling Point | 722.7ºC at 760 mmHg |
| Flash Point | 404.8ºC |
| Exact Mass | 532.30400 |
| PSA | 149.20000 |
| LogP | 3.10230 |