Home
Products
Ganoderic acid H
| Product Name | Ganoderic acid H |
| Price: | $584 / 5mg |
| Catalog No.: | CN07726 |
| CAS No.: | 98665-19-1 |
| Molecular Formula: | C32H44O9 |
| Molecular Weight: | 572.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)CC(C1CC(=O)C2(C1(C)[C@H](OC(=O)C)C(=O)C1=C2C(=O)CC2C1(C)CC[C@@H](C2(C)C)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid H is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderic acid H suppresses growth and invasive behavior of breast cancer cells through the inhibition of transcription factors AP-1 and NF-kappaB signaling[1]. |
| Density | 1.25g/cm3 |
| Boiling Point | 710ºC at 760 mmHg |
| Flash Point | 222.5ºC |
| PSA | 152.11000 |
| LogP | 3.63530 |