Home
Products
Pseudoginsenoside RT1
| Product Name | Pseudoginsenoside RT1 |
| Price: | $234 / 10mg |
| Catalog No.: | CN07564 |
| CAS No.: | 98474-74-9 |
| Molecular Formula: | C47H74O18 |
| Molecular Weight: | 927.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)[C@]23CC[C@@]4(C(=CC[C@H]5[C@@]4(C)C[C@@H](O)[C@@H]4[C@]5(C)CC[C@@H](C4(C)C)O[C@@H]4O[C@H](C(=O)O)[C@H]([C@@H]([C@H]4O[C@@H]4OC[C@H]([C@@H]([C@H]4O)O)O)O)O)[C@@H]3CC(CC2)(C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudoginsenoside RT1, isolated from the fruit of Randia siamensis, exhibits acute ichthyotoxic activity[1]. |
| Density | 1.42±0.1 g/cm3 |
| Boiling Point | 987.3±65.0 °C(Predicted) |
| Exact Mass | 926.48800 |
| PSA | 291.82000 |
| LogP | 0.87190 |