Home
Products
Hupehenine
| Product Name | Hupehenine |
| Price: | $146 / 20mg |
| Catalog No.: | CN01282 |
| CAS No.: | 98243-57-3 |
| Molecular Formula: | C27H45NO2 |
| Molecular Weight: | 415.65 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbus of Fritillaria thunbergii Miq. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@H](C1)[C@H](O)C[C@@H]1[C@@H]2C[C@@H]2[C@H]1CC[C@@H]1[C@H]2CN2C[C@@H](C)CC[C@H]2[C@@H]1C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hupehenine, a bioactive isosteroidal alkaloid, is a main antitussive components present in most of Fritillariae Bulbus[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 538.0±35.0 °C at 760 mmHg |
| Flash Point | 250.4±24.6 °C |
| Exact Mass | 415.345032 |
| PSA | 43.70000 |
| LogP | 5.85 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | 2-8C |