Home
Products
Methyl (E)-3'-hydroxy-4'-methoxycinnamate
| Product Name | Methyl (E)-3'-hydroxy-4'-methoxycinnamate |
| Price: | Inquiry |
| Catalog No.: | CN06914 |
| CAS No.: | 97966-29-5 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Phyllostachys heterocycla |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)/C=C/c1ccc(c(c1)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.204 |
| Boiling Point | 370 ºC |
| Flash Point | 145 ºC |
| Exact Mass | 208.07400 |
| PSA | 55.76000 |
| LogP | 1.58700 |