Home
Products
Methyl 3-carbazolecarboxylate
| Product Name | Methyl 3-carbazolecarboxylate |
| Price: | Inquiry |
| Catalog No.: | CN01394 |
| CAS No.: | 97931-41-4 |
| Molecular Formula: | C14H11NO2 |
| Molecular Weight: | 225.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Micromelum sp. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)c1ccc2c(c1)c1ccccc1[nH]2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methylcarbazole-3-carboxylate is a carbazole alkaloid can be isolated from the peel of Clausena lansium (Lour.) Skeels[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 421.1±18.0 °C at 760 mmHg |
| Flash Point | 208.5±21.2 °C |
| Exact Mass | 225.078979 |
| PSA | 42.09000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |