Home
Products
Hydroxy-beta-sanshool
| Product Name | Hydroxy-beta-sanshool |
| Price: | $234 / 10mg |
| Catalog No.: | CN00706 |
| CAS No.: | 97465-69-5 |
| Molecular Formula: | C16H25NO2 |
| Molecular Weight: | 263.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Zanthoxylum bungeanum Maxim. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C/C=C/C=C/CC/C=C/C(=O)NCC(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hydroxy-β-sanshool is an alkylamide exists in Zanthoxylum bungeanum oil and Zanthoxylum schinifolium oil[1]. |
| Density | 0.973 g/cm3 |
| Boiling Point | 471.5±45.0℃ at 760 mmHg |