Home
Products
5,6,7-Trimethoxyflavone
| Product Name | 5,6,7-Trimethoxyflavone |
| Price: | $234 / 5mg |
| Catalog No.: | CN04308 |
| CAS No.: | 973-67-1 |
| Molecular Formula: | C18H16O5 |
| Molecular Weight: | 312.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Callicarpa japonica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2oc(cc(=O)c2c(c1OC)OC)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5,6,7-Trimethoxyflavone is a novel p38-α MAPK inhibitor with an anti-inflammatory effect. 5,6,7-Trimethoxyflavone is isolated from several plants including Zeyhera tuberculosa, Callicarpa japonica, and Kickxia lanigera[1]. |
| Target | p38-α MAPK[1] |
| Density | 1.242g/cm3 |
| Boiling Point | 497.4ºC at 760 mmHg |
| Flash Point | 221.3ºC |
| Exact Mass | 312.10000 |
| PSA | 57.90000 |
| LogP | 3.48580 |
| Storage condition | -20℃ |