Home
Products
(+)-Gallocatechin
| Product Name | (+)-Gallocatechin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05549 |
| CAS No.: | 970-73-0 |
| Molecular Formula: | C15H14O7 |
| Molecular Weight: | 306.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | White powder |
| Source: | The woods of Acacia catechu (L.F.) Willd. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc2O[C@H](c3cc(O)c(c(c3)O)O)[C@H](Cc2c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Gallocatechin is a polyphenol compound from green tea, possesses anticancer activity[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 685.6±55.0 °C at 760 mmHg |
| Flash Point | 368.5±31.5 °C |
| Exact Mass | 306.073944 |
| PSA | 130.61000 |
| LogP | -0.10 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Storage condition | -20℃ |