Home
Products
Quercetin 3-O-malonylglucoside
| Product Name | Quercetin 3-O-malonylglucoside |
| Price: | $336 / 5mg |
| Catalog No.: | CN04277 |
| CAS No.: | 96862-01-0 |
| Molecular Formula: | C24H22O15 |
| Molecular Weight: | 550.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Prunella vulgaris L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)CC(=O)OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quercetin 3-O-(6''-O-malonyl)-β-D-glucoside, a natural flavonol glycoside, possesses antioxidant activity[1]. |
| Exact Mass | 550.09600 |
| PSA | 253.88000 |