Home
Products
Maoecrystal A
| Product Name | Maoecrystal A |
| Price: | $161 / 5mg |
| Catalog No.: | CN08824 |
| CAS No.: | 96850-30-5 |
| Molecular Formula: | C22H28O6 |
| Molecular Weight: | 388.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rabdosia amethystoides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H]1C(=C)[C@H]2C[C@]31C(=O)[C@@H](O)[C@H]1[C@@]4([C@@H]3CC2)CO[C@@H](C1(C)C)CC4=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Maoecrystal A is a compound isolated from leaves of Isodon eriocalyx[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 550.8±50.0 °C at 760 mmHg |
| Flash Point | 191.1±23.6 °C |
| Exact Mass | 388.188599 |
| PSA | 89.90000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |