Home
Products
Stylopine hydrochloride
| Product Name | Stylopine hydrochloride |
| Price: | Inquiry |
| Catalog No.: | CN00947 |
| CAS No.: | 96087-21-7 |
| Molecular Formula: | C19H18ClNO4 |
| Molecular Weight: | 359.81 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The leaves of Chelidonium majus L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C1Oc2c(O1)cc1c(c2)CC[NH+]2C1Cc1ccc3c(c1C2)OCO3.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Stylopine hydrochloride (Tetrahydrocoptisine hydrochloride) is an alkaloid compound originally isolated from Corydalis tubers that exhibits anti-inflammatory and anti-parasitic activities[1][2]. |
| Exact Mass | 359.092438 |
| Storage condition | -20℃ |