Home
Products
4'-Methoxychalcone
| Product Name | 4'-Methoxychalcone |
| Price: | Inquiry |
| Catalog No.: | CN04376 |
| CAS No.: | 959-23-9 |
| Molecular Formula: | C16H14O2 |
| Molecular Weight: | 238.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The heartwoods of Caesalpinia sappan Linn |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)C(=O)/C=C/c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4'-Methoxychalcone regulates adipocyte differentiation through PPARγ activation. 4'-Methoxychalcone modulates the expression and secretion of various adipokines in adipose tissue that are involved in insulin sensitivity[1]. |
| Target | PPARγ[1] |
| In Vitro | 4'-Methoxychalcone (5 μM; 8 days) markedly increases the mRNA expression of adipogenic genes during adipocyte differentiation, PPARγ, aP2, FAS, adiponectin and GluT 4[1]. 4'-Methoxychalcone (5 μM; 8 days) reduces the upregulated mRNA expression of IL-6, PAI-1, and MCP-1 by TNF-α in preadipocyte 3T3-L1 cells[1]. 4'-Methoxychalcone (5 μM; 0-8 days) causes an increase in PPARγ expression during differentiation, while C/EBPβ protein expression is relatively unaffected[1]. RT-PCR[1] Cell Line: Preadipocyte 3T3-L1 cells Concentration: 5 μM Incubation Time: 0 day; 2 days; 4 days; 6 days; 8 days Result: Increased the mRNA expression of all adipogenic genes, except GluT1 in adipocyte. Western Blot Analysis[1] Cell Line: Preadipocyte 3T3-L1 cells Concentration: 5 μM Incubation Time: 8 days Result: Increased PPARγ expression in adipocyte. |
| Density | 1.114g/cm3 |
| Boiling Point | 397.5ºC at 760mmHg |
| Flash Point | 180.5ºC |
| Exact Mass | 238.09900 |
| PSA | 26.30000 |
| LogP | 3.59130 |