Home
Products
Isolinderalactone
| Product Name | Isolinderalactone |
| Price: | $351 / 10mg |
| Catalog No.: | CN09508 |
| CAS No.: | 957-66-4 |
| Molecular Formula: | C15H16O3 |
| Molecular Weight: | 244.29 g/mol |
| Purity: | >95% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Lindera aggregata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C[C@@]1(C)Cc2occ(c2[C@H]2[C@@H]1C(=C)C(=O)O2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isolinderalactone suppresses human glioblastoma growth and angiogenic activity through the inhibition of VEGFR2 activation in endothelial cells[1]. Isolinderalactone suppresses the expression of B-cell lymphoma 2 (Bcl-2), survi |
| Target | VEGFR2 Bcl-2 |
| Exact Mass | 244.11000 |
| PSA | 39.44000 |
| LogP | 3.10670 |
| Storage condition | -20℃ |