Home
Products
Ganoderic acid C1
| Product Name | Ganoderic acid C1 |
| Price: | $234 / 5mg |
| Catalog No.: | CN07729 |
| CAS No.: | 95311-97-0 |
| Molecular Formula: | C30H42O7 |
| Molecular Weight: | 514.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(C[C@H](C(=O)O)C)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid C1, a natural compound that could be isolated from G. lucidum, suppresses TNF-α production by murine macrophages (RAW 264.7 cells)[1]. |
| Density | 1.22g/cm3 |
| Boiling Point | 688.3ºC at 760mmHg |
| Flash Point | 384.1ºC |
| Exact Mass | 514.29300 |
| PSA | 125.81000 |
| LogP | 4.33970 |