Home
Products
Lucidenic acid A
| Product Name | Lucidenic acid A |
| Price: | $219 / 5mg |
| Catalog No.: | CN07575 |
| CAS No.: | 95311-94-7 |
| Molecular Formula: | C27H38O6 |
| Molecular Weight: | 458.59 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)CC[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lucideric acid A is a natural compound isolated from Ganoderma lucidum, inhibits PMA-induced MMP-9 activity, with anti-invasive effect on hepatoma cells[1]. |
| Target | MMP-9[1] |
| Density | 1.22±0.1 g/cm3 (20 °C, 760 mmHg) |
| Boiling Point | 640.1±55.0 °C (760 mmHg) |
| Exact Mass | 458.26700 |
| PSA | 108.74000 |
| LogP | 4.13450 |
| Storage condition | 2-8℃ |