Home
Products
Kajiichigoside F1
| Product Name | Kajiichigoside F1 |
| Price: | $511 / 5mg |
| Catalog No.: | CN07394 |
| CAS No.: | 95298-47-8 |
| Molecular Formula: | C36H58O10 |
| Molecular Weight: | 650.84 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Rosa rugosa. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)[C@@]23CC[C@H]([C@@]([C@H]3C3=CC[C@H]4[C@@]([C@@]3(CC2)C)(C)CC[C@@H]2[C@]4(C)C[C@H]([C@H](C2(C)C)O)O)(C)O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaji-ichigoside F1 is isolated from S. cuneata with hemolytic and in vitro antiviral activity.[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 741.5±60.0 °C at 760 mmHg |
| Flash Point | 223.6±26.4 °C |
| Exact Mass | 650.403015 |
| LogP | 5.33 |
| Vapour Pressure | 0.0±5.6 mmHg at 25°C |
| Storage condition | 2-8℃ |