Home
Products
Yadanziolide A
| Product Name | Yadanziolide A |
| Price: | $351 / 5mg |
| Catalog No.: | CN08451 |
| CAS No.: | 95258-14-3 |
| Molecular Formula: | C20H26O10 |
| Molecular Weight: | 426.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Brucea javanica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC12OCC34C2(O)C(O)C(=O)OC4CC2C(C3C(C1O)O)(C)C(O)C(=O)C=C2C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Yadanziolide A, isolated from the cultivated dry seeds of Brucea javanica, has strong antiviral activities with IC50 of 5.5 μM against tobacco mosaic virus. Yadanziolide A shows significant antitumor effects[1][2]. |
| Target | IC50: 5.5 μM (Tobacco mosaic virus)[1] |
| Density | 1.68±0.1 g/cm3 |
| Exact Mass | 426.15300 |
| PSA | 173.98000 |