Home
Products
Parishin E
| Product Name | Parishin E |
| Price: | $146 / 10mg |
| Catalog No.: | CN03738 |
| CAS No.: | 952068-57-4 |
| Molecular Formula: | C19H24O13 |
| Molecular Weight: | 460.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Gastrodia elata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)COC(=O)CC(C(=O)O)(CC(=O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Parishin E, a parishin derivative isolated from Gastrodia elata, may have antioxidant property[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 784.1±60.0 °C at 760 mmHg |
| Flash Point | 274.8±26.4 °C |
| Exact Mass | 460.121704 |
| PSA | 220.51000 |
| LogP | -1.57 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |