Home
Products
2'-Desoxyuridine
| Product Name | 2'-Desoxyuridine |
| Price: | $31 / 20mg |
| Catalog No.: | CN00019 |
| CAS No.: | 951-78-0 |
| Molecular Formula: | C9H12N2O5 |
| Molecular Weight: | 228.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Heracleum stenopterum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](C[C@@H]1O)n1ccc(=O)[nH]c1=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2'-Deoxyuridine could increase chromosome breakage and results in a decreased thymidylate synthetase activity. A known use of 2'-Deoxyuridine is as a precursor in the synthesis of Edoxudine. |
| Target | Human Endogenous Metabolite |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 228.074615 |
| PSA | 104.55000 |
| LogP | -1.70 |
| Storage condition | 0-6°C |