Home
Products
2'-Deoxycytidine
| Product Name | 2'-Deoxycytidine |
| Price: | Inquiry |
| Catalog No.: | CN00020 |
| CAS No.: | 951-77-9 |
| Molecular Formula: | C9H13N3O4 |
| Molecular Weight: | 227.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The peels of Punica granatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](C[C@@H]1O)n1ccc(nc1=O)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2'-Deoxycytidine, a deoxyribonucleoside, could inhibit biological effects of Bromodeoxyuridine (Brdu). |
| Target | Human Endogenous Metabolite Brdu |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 482.1±55.0 °C at 760 mmHg |
| Flash Point | 245.4±31.5 °C |
| PSA | 119.83000 |
| LogP | -1.73 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Storage condition | Store at RT. |