Home
Products
4''-methyloxy-Genistin
| Product Name | 4''-methyloxy-Genistin |
| Price: | $277 / 5mg |
| Catalog No.: | CN04530 |
| CAS No.: | 950910-16-4 |
| Molecular Formula: | C22H22O10 |
| Molecular Weight: | 446.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max (L.) merr. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1OC)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4''-methyloxy-Genistin, an isoflavone methyl-glycoside, is isolated from Cordyceps militaris grown on germinated soybeans. Isoflavones possess immunomodulating and antiallergic activities[1]. |