Home
Products
Gypenoside L
| Product Name | Gypenoside L |
| Price: | $380 / 5mg |
| Catalog No.: | CN07175 |
| CAS No.: | 94987-09-4 |
| Molecular Formula: | C42H72O14 |
| Molecular Weight: | 801.0 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Gynostemma pentaphyllum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)C[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3[C@](CCC=C(C)C)(O)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gypenoside L is a saponin that can be found in Gynostemma pentaphyllum. Gypenoside L increases the SA-β-galactosidase activity, promotes the production of senescence-associated secretory cytokines. Gypenoside L also can activate p38 and ERK MAPK pathways and NF-κB pathway to induce senescence. Gypenoside L exhibits anti-tumor and anti-inflammatory activities[1][2]. |
| In Vitro | Gypenoside L (20-80 μg/mL; 24 h) increases the mRNA expression levels of SASP, such as IL-1α, IL-6, TIMP-1, CXCL-1 and CXCL-2 in HepG2 and ECA-109 cells[1]. Gypenoside L (20-80 μg/mL; 24 h) causes cell cycle arrest at S phase[1]. GPL (3.125-100 μg/mL) significantly inhibits LPS-induced NO accumulation in RAW264.7 cells[2]. |
| Density | 1.33±0.1 g/cm3(Predicted) |
| Boiling Point | 912.3±65.0 °C(Predicted) |