Home
Products
Isolicoflavonol
| Product Name | Isolicoflavonol |
| Price: | Inquiry |
| Catalog No.: | CN05206 |
| CAS No.: | 94805-83-1 |
| Molecular Formula: | C20H18O6 |
| Molecular Weight: | 354.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Broussonetia kazinoki Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1cc(ccc1O)c1oc2cc(O)cc(c2c(=O)c1O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isolicoflavonol potently inhibits hCES2A（Human carboxylesterase 2）-mediated fluorescein diacetate hydrolysis in a reversible and mixed inhibition manner, with Ki values less than 1.0 μM[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 601.2±55.0 °C at 760 mmHg |
| Flash Point | 217.4±25.0 °C |
| Exact Mass | 354.110352 |
| PSA | 111.13000 |
| LogP | 4.15 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | 2-8C |