Home
Products
Glycycoumarin
| Product Name | Glycycoumarin |
| Price: | $161 / 5mg |
| Catalog No.: | CN06083 |
| CAS No.: | 94805-82-0 |
| Molecular Formula: | C21H20O6 |
| Molecular Weight: | 368.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Licorice. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(CC=C(C)C)c(O)cc2c1cc(c(=O)o2)c1ccc(cc1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glycycoumarin is a major bioactive coumarin of licorice. Glycycoumarin inhibits hepatocyte lipoapoptosis through activation of autophagy and inhibition of ER stress-mediated JNK and GSK-3-mediated mitochondrial pathway. Glycycoumarin exerts anti-liver cancer activity by directly targeting T-LAK cell-originated protein kinase [1] [2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 646.9±55.0 °C at 760 mmHg |
| Flash Point | 232.0±25.0 °C |
| Exact Mass | 368.125977 |
| PSA | 100.13000 |
| LogP | 5.99 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |