Home
Products
Gypenoside XLVI
| Product Name | Gypenoside XLVI |
| Price: | $321 / 10mg |
| Catalog No.: | CN07510 |
| CAS No.: | 94705-70-1 |
| Molecular Formula: | C48H82O19 |
| Molecular Weight: | 963.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax notoginseng (Burk.) F.H.Chen |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2C(O)CC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(OC2OC(CO)C(C(C2O)O)O)(CCC=C(C)C)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gypenoside XLVI is one of the major dammarane-type triterpenoid saponins from Gynostamma pentaphallum[1]. Gypenoside XLVI has a tetracyclic triterpene structure and possess potent non-small cell lung carcinoma A549 cell inhibitory activity[2]. |
| Storage condition | 2-8C |