Home
Products
Senkyunolide H
| Product Name | Senkyunolide H |
| Price: | $146 / 10mg |
| Catalog No.: | CN06718 |
| CAS No.: | 94596-27-7 |
| Molecular Formula: | C12H16O4 |
| Molecular Weight: | 224.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The roots of Ligusticum chuanxiong hort |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCC/C=C/1OC(=O)C2=C1CC[C@H]([C@H]2O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Senkyunolide H is a natural compound isolated from Ligusticum chuanxiong Hort[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 444.8±45.0 °C at 760 mmHg |
| Flash Point | 175.1±22.2 °C |
| Exact Mass | 224.104858 |
| PSA | 66.76000 |
| LogP | 1.04 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | 2-8℃ |