Home
Products
2'-Acetylacteoside
| Product Name | 2'-Acetylacteoside |
| Price: | $131 / 10mg |
| Catalog No.: | CN06853 |
| CAS No.: | 94492-24-7 |
| Molecular Formula: | C31H38O16 |
| Molecular Weight: | 666.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cistanche deserticola Y.C. Ma |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OCCc2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1OC(=O)/C=C/c1ccc(c(c1)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2'-Acetylacteoside is a phenylethanoid glycoside isolated from Brandisia hancei, inhibits free radical-induced hemolysis of red blood cells and exhibits free radical scavenging activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 892.2±65.0 °C at 760 mmHg |
| Flash Point | 283.9±27.8 °C |
| Exact Mass | 666.216003 |
| PSA | 251.36000 |
| LogP | 3.04 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |