Home
Products
Angelic anhydride
| Product Name | Angelic anhydride |
| Price: | Inquiry |
| Catalog No.: | CN06542 |
| CAS No.: | 94487-74-8 |
| Molecular Formula: | C10H14O3 |
| Molecular Weight: | 182.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The roots of Angelica sinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(C(=O)OC(=O)/C(=CC)/C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Angelic anhydride is an aliphatic acid anhydride from unsaturated hydrocarbon acid anhydrides[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 278.5±9.0 °C at 760 mmHg |
| Flash Point | 119.8±15.9 °C |
| Exact Mass | 182.094299 |
| PSA | 43.37000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |