Home
Products
Bacopaside X
| Product Name | Bacopaside X |
| Price: | $439 / 10mg |
| Catalog No.: | CN07226 |
| CAS No.: | 94443-88-6 |
| Molecular Formula: | C46H74O17 |
| Molecular Weight: | 899.08 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Bacopa monnieri |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@H]1O[C@H]([C@@H]([C@H]1O)O)O[C@H]1[C@@H](OC[C@@H]([C@@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC[C@H]2[C@@]31CO[C@]1(C3)[C@@H]2[C@@](C)(O)C[C@@H](O1)C=C(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bacopaside X is found in Bacopa monnieri, and shows a binding affinity toward the D1 receptor[1]. |
| Density | 1.41 |
| Exact Mass | 898.49300 |
| PSA | 255.91000 |
| LogP | 0.60580 |
| Storage condition | 2-8°C |