Home
Products
Tetrachlorohydroquinone dimethyl ether
| Product Name | Tetrachlorohydroquinone dimethyl ether |
| Price: | Inquiry |
| Catalog No.: | CN03859 |
| CAS No.: | 944-78-5 |
| Molecular Formula: | C8H6Cl4O2 |
| Molecular Weight: | 275.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(Cl)c(Cl)c(c(c1Cl)Cl)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1,2,4,5-Tetrachloro-3,6-dimethoxybenzene is an active compound. 1,2,4,5-Tetrachloro-3,6-dimethoxybenzene can be used for the research of various biochemical studies[1]. |
| Density | 1.489g/cm3 |
| Boiling Point | 330.1ºC at 760mmHg |
| Flash Point | 128.4ºC |
| Exact Mass | 273.91200 |
| PSA | 18.46000 |
| LogP | 4.31740 |