Home
Products
Methylnissolin-3-O-glucoside
| Product Name | Methylnissolin-3-O-glucoside |
| Price: | Inquiry |
| Catalog No.: | CN04826 |
| CAS No.: | 94367-42-7 |
| Molecular Formula: | C23H26O10 |
| Molecular Weight: | 462.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Astragalus sinicus L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc3c(c2)OC[C@@H]2[C@H]3Oc3c2ccc(c3OC)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methylnissolin-3-O-glucoside (Methylnissolin-3-O-β-D-glucoside) is a flavonoid from the roots of Astragalus membranaceus with anti-inflammatory effects[1]. |
| Density | 1.456±0.06 g/cm3 (20 °C, 760 mmHg) |
| Boiling Point | 646.3±55.0 °C (760 mmHg) |
| Exact Mass | 462.15300 |
| PSA | 136.30000 |
| LogP | 0.49220 |