Home
Products
Sappanchalcone
| Product Name | Sappanchalcone |
| Price: | Inquiry |
| Catalog No.: | CN05671 |
| CAS No.: | 94344-54-4 |
| Molecular Formula: | C16H14O5 |
| Molecular Weight: | 286.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Orange powder |
| Source: | The heartwoods of Caesalpinia sappan L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)ccc1C(=O)C=Cc1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sappanchalcone, a flavonoid isolated from Caesalpinia sappan L., induces caspase-dependent and AIF-dependent apoptosis in human colon cancer cells[1]. |
| In Vitro | Sappanchalcone has a statistically significant effect on HCT116 cells than on SW480 cells (IC50= 37.33 μM and 54.23 μM, respectively). Sappanchalcone reduces MMP with a significant increase in ROS levels in human colon cancer cells. Sappanchalcone triggered phosphorylation of p53, which is involved in the activation of caspases and increased expression of Bax in HCT116 cells[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 581.7±50.0 °C at 760 mmHg |
| Flash Point | 221.0±23.6 °C |
| Exact Mass | 286.084137 |
| PSA | 86.99000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |