Home
Products
Poliumoside
| Product Name | Poliumoside |
| Price: | $103 / 20mg |
| Catalog No.: | CN07013 |
| CAS No.: | 94079-81-9 |
| Molecular Formula: | C35H46O19 |
| Molecular Weight: | 770.73 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Callicarpa dichotoma |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(OC1C(COC2OC(C)C(C(C2O)O)O)OC(C(C1OC1OC(C)C(C(C1O)O)O)O)OCCc1ccc(c(c1)O)O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Poliumoside is a natural compound which exhibit significant inhibition of advanced glycation end product formation with IC50 value of 4.6-25.7 μM.IC50 value: Target: Poliumoside exhibited greater inhibitory effects on rat lens aldose reductase with IC50 values of 0.85 μM, than those of the positive controls, 3,3-tetramethyleneglutaric acid (IC50=4.03 μM) and quercetin (IC50=7.2 μM). |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1023.2±65.0 °C at 760 mmHg |
| Flash Point | 316.2±27.8 °C |
| Exact Mass | 770.263306 |
| PSA | 304.21000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |