Home
Products
Forsythoside E
| Product Name | Forsythoside E |
| Price: | $131 / 10mg |
| Catalog No.: | CN06874 |
| CAS No.: | 93675-88-8 |
| Molecular Formula: | C20H30O12 |
| Molecular Weight: | 462.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Forsythia suspensa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H](O)[C@H](OCCc2ccc(c(c2)O)O)O[C@@H]([C@H]1O)CO[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Forsythoside E is a phenylethanoid glycoside isolated from the fruits of forsythia suspense (thunb.) vahl[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 752.0±60.0 °C at 760 mmHg |
| Flash Point | 408.6±32.9 °C |
| Exact Mass | 462.173737 |
| PSA | 198.76000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |