Home
Products
8-Deacetylyunaconitine
| Product Name | 8-Deacetylyunaconitine |
| Price: | Inquiry |
| Catalog No.: | CN00860 |
| CAS No.: | 93460-55-0 |
| Molecular Formula: | C33H47NO10 |
| Molecular Weight: | 617.73 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum Vilmorinian Radix. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COCC12CN(CC)C3C4(C2C(OC)C3C2(C3C4CC(C3OC(=O)c3ccc(cc3)OC)(C(C2)OC)O)O)C(CC1O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 8-Deacetylyunaconitine, a diterpenoid alkaloid, can be found in the root extract of A. forrestii[1]. |
| Storage condition | 2-8℃ |