Home
Products
Chamaechromone
| Product Name | Chamaechromone |
| Price: | $293 / 5mg |
| Catalog No.: | CN04981 |
| CAS No.: | 93413-00-4 |
| Molecular Formula: | C30H22O10 |
| Molecular Weight: | 542.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Stellera chamaejasme |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C(C(c1coc2c(c1=O)c(O)cc(c2)O)C(=O)c1c(O)cc(cc1O)O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chamaechromone is a biflavonoid ingredient isolated from the roots of Stellera chamaejasme L. (Thymelaeaceae). Chamaechromone possesses anti-hepatitis B virus (HBV) effects against the surface antigen of HBV (HBsAg) secretion and has insecticidal activities[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 906.4±65.0 °C at 760 mmHg |
| Flash Point | 304.2±27.8 °C |
| Exact Mass | 542.121277 |
| LogP | 5.84 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |