Home
Products
Cistanoside A
| Product Name | Cistanoside A |
| Price: | $190 / 10mg |
| Catalog No.: | CN06896 |
| CAS No.: | 93236-42-1 |
| Molecular Formula: | C36H48O20 |
| Molecular Weight: | 800.75 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cistanche deserticola Ma |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OCCc3ccc(c(c3)OC)O)[C@@H]([C@H]([C@@H]2OC(=O)/C=C/c2ccc(c(c2)O)O)O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cistanoside A is a phenylethanoid isolated from Cistanche deserticola, reduces NO accumulation, but shows no effect on iNOS mRNA, iNOS protein levels or iNOS activity. Anti-inflammatory effect[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1058.1±65.0 °C at 760 mmHg |
| Flash Point | 324.2±27.8 °C |
| Exact Mass | 800.273865 |
| PSA | 313.44000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |