Home
Products
Kaempferol 3-sophoroside-7-rhamnoside
| Product Name | Kaempferol 3-sophoroside-7-rhamnoside |
| Price: | $467 / 5mg |
| Catalog No.: | CN04879 |
| CAS No.: | 93098-79-4 |
| Molecular Formula: | C33H40O20 |
| Molecular Weight: | 756.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Elaeagnus multiflora Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2c(oc3c(c2=O)c(O)cc(c3)OC2OC(C)C(C(C2O)O)O)c2ccc(cc2)O)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol 3-sophoroside 7-rhamnoside, isolated from Solanum tuberosum (potato), acts as a potential biomarker[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 1111.4±65.0 °C at 760 mmHg |
| Flash Point | 349.5±27.8 °C |
| Exact Mass | 756.211304 |
| PSA | 328.35000 |
| LogP | -1.08 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |