Home
Products
Skimmin
| Product Name | Skimmin |
| Price: | $117 / 10mg |
| Catalog No.: | CN06217 |
| CAS No.: | 93-39-0 |
| Molecular Formula: | C15H16O8 |
| Molecular Weight: | 324.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Hydrangea paniculata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc3c(c2)oc(=O)cc3)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Skimmin (Umbelliferone glucoside) is a coumarin found in Hydrangea paniculata, inhibits immune complex deposition, with anti-inflammatory activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 632.0±55.0 °C at 760 mmHg |
| Flash Point | 239.3±25.0 °C |
| Exact Mass | 324.084503 |
| PSA | 129.59000 |
| LogP | -1.50 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |