Home
Products
Acetylisoeugenol
| Product Name | Acetylisoeugenol |
| Price: | $15 / 25mg |
| Catalog No.: | CN06833 |
| CAS No.: | 93-29-8 |
| Molecular Formula: | C12H14O3 |
| Molecular Weight: | 206.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | From Cinnamon bark oil. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C/c1ccc(c(c1)OC)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoeugenol acetate, an essential oil constituent of nutmeg, clove, and cinnamon, shows excellent inhibitory effects against some metabolic enzymes such as acetylcholinesterase (AChE) enzymes (IC50=77 nM; Ki=16 nM), α-glycosidase (IC50=19.25 nM; Ki=21 nM), and α-amylase (IC50=411.5 nM). Isoeugenol acetate is used medical and cosmetics industries for its antioxidant, anticancer, antimicrobial and anti-inflammatory properties[1][2]. |
| Target | IC50: 77 nM (AChE), 19.25 nM (α-glycosidase), 411.5 nM (α-amylase)[1] Ki: 16 nM (AChE), 21 nM (α-glycosidase)[1] |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 283.0±20.0 °C at 760 mmHg |
| Flash Point | 113.9±16.4 °C |
| Exact Mass | 206.094299 |
| PSA | 35.53000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |